Difference between revisions of "PWY-6146"

Revision as of 20:16, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18319 CPD-18319] ==
+== Pathway PWY-7657 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** n-3-(r,r)-epoxysuccinamoyl-(s)-2,3-diaminopropanoate
+** dtdp-&beta;-l-digitoxose biosynthesis
-* smiles:
+== Reaction(s) found ==
-** c(nc(=o)c1(oc(c(=o)n)1))c([n+])c(=o)[o-]
+* [[DTDPGLUCDEHYDRAT-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** lqrxqgmibgpnby-pzgqecojsa-n
+* [NoneRXN-12943 RXN-12943]
-* molecular-weight:
+* [NoneRXN-16262 RXN-16262]
-** 217.181
+* [NoneRXN-11993 RXN-11993]
-== Reaction(s) known to consume the compound ==
+* [NoneDTDPGLUCOSEPP-RXN DTDPGLUCOSEPP-RXN]
-* [[RXN-16991]]
+* [NoneRXN-12404 RXN-12404]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-16566 RXN-16566]
-== Reaction(s) of unknown directionality ==
+{{#set: taxonomic-range=tax-2}}
-{{#set: common-name=n-3-(r,r)-epoxysuccinamoyl-(s)-2,3-diaminopropanoate}}
+{{#set: common-name=dtdp-&beta;-l-digitoxose biosynthesis}}
-{{#set: inchi-key=inchikey=lqrxqgmibgpnby-pzgqecojsa-n}}
+{{#set: nb reaction found=1}}
-{{#set: molecular-weight=217.181}}
+{{#set: completion rate=0.14}}
+{{#set: nb total reaction=7}}