Difference between revisions of "PWY0-1299"

Revision as of 20:16, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7649 CPD-7649] ==
+== Pathway PWY-6982 ==
+* taxonomic-range:
+** tax-33090
 * common-name:
-** dopamine 3-o-sulfate
+** umbelliferone biosynthesis
-* smiles:
+== Reaction(s) found ==
-** c1(=c(cc[n+])c=c(os(=o)(=o)[o-])c(o)=c1)
+* [[4-COUMARATE--COA-LIGASE-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** nzkryjgnypyxjz-uhfffaoysa-n
+* [NoneRXN-12965 RXN-12965]
-* molecular-weight:
+* [NoneRXN-12963 RXN-12963]
-** 233.239
+{{#set: taxonomic-range=tax-33090}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=umbelliferone biosynthesis}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=1}}
-* [[RXN6666-9]]
+{{#set: completion rate=0.33}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb total reaction=3}}
-{{#set: common-name=dopamine 3-o-sulfate}}
-{{#set: inchi-key=inchikey=nzkryjgnypyxjz-uhfffaoysa-n}}
-{{#set: molecular-weight=233.239}}