Difference between revisions of "PWY-5137"

Revision as of 20:16, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-ALA-D-ALA D-ALA-D-ALA] ==
+== Pathway PWY-6840 ==
+* taxonomic-range:
+** tax-3803
 * common-name:
-** d-alanyl-d-alanine
+** homoglutathione biosynthesis
-* smiles:
+== Reaction(s) found ==
-** cc([n+])c(=o)nc(c)c([o-])=o
+* [[GLUTCYSLIG-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** defjqiddeaulhb-qwwzwvqmsa-n
+* [NoneHOMOGLUTATHIONE-SYNTHASE-RXN HOMOGLUTATHIONE-SYNTHASE-RXN]
-* molecular-weight:
+{{#set: taxonomic-range=tax-3803}}
-** 160.172
+{{#set: common-name=homoglutathione biosynthesis}}
-== Reaction(s) known to consume the compound ==
+{{#set: nb reaction found=1}}
-== Reaction(s) known to produce the compound ==
+{{#set: completion rate=0.5}}
-* [[DALADALALIG-RXN]]
+{{#set: nb total reaction=2}}
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=d-alanyl-d-alanine}}
-{{#set: inchi-key=inchikey=defjqiddeaulhb-qwwzwvqmsa-n}}
-{{#set: molecular-weight=160.172}}