Difference between revisions of "ASPARAGINE-DEG1-PWY"

Revision as of 20:17, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4207 CPD-4207] ==
+== Pathway CYSTEINE-DEG-PWY ==
+* taxonomic-range:
+** tax-40674
 * common-name:
-** isopentenyl adenosine
+** l-cysteine degradation i
-* smiles:
+== Reaction(s) found ==
-** cc(c)=ccnc3(=nc=nc2(n(c1(c(c(c(o1)co)o)o))c=nc=23))
+* [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]]
-* inchi-key:
+* [[CYSTEINE-DIOXYGENASE-RXN]]
-** usvmjsalorzvdv-sdbhatresa-n
+== Reaction(s) not found ==
-* molecular-weight:
+* [None3-SULFINYL-PYRUVATE-SPON-RXN 3-SULFINYL-PYRUVATE-SPON-RXN]
-** 335.362
+{{#set: taxonomic-range=tax-40674}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=l-cysteine degradation i}}
-* [[RXN-4315]]
+{{#set: nb reaction found=2}}
-* [[RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.]]
+{{#set: completion rate=0.67}}
-* [[RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.]]
+{{#set: nb total reaction=3}}
-== Reaction(s) known to produce the compound ==
-* [[RXN-4315]]
-* [[RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.]]
-* [[RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=isopentenyl adenosine}}
-{{#set: inchi-key=inchikey=usvmjsalorzvdv-sdbhatresa-n}}
-{{#set: molecular-weight=335.362}}