Difference between revisions of "P261-PWY"

Revision as of 20:17, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=R-1-AMINOPROPAN-2-YL-PHOSPHATE R-1-AMINOPROPAN-2-YL-PHOSPHATE] ==
+== Pathway P105-PWY ==
+* taxonomic-range:
+** tax-1117
+** tax-3035
+** tax-1224
+** tax-201174
 * common-name:
-** (r)-1-amino-2-propanol o-2-phosphate
+** tca cycle iv (2-oxoglutarate decarboxylase)
-* smiles:
+== Reaction(s) found ==
-** cc(c[n+])op(=o)([o-])[o-]
+* [[ACONITATEDEHYDR-RXN]]
-* inchi-key:
+* [[ACONITATEHYDR-RXN]]
-** ybolzujjguzudc-gsvougtgsa-m
+* [[CITSYN-RXN]]
-* molecular-weight:
+* [[FUMHYDR-RXN]]
-** 154.082
+* [[ISOCIT-CLEAV-RXN]]
-== Reaction(s) known to consume the compound ==
+* [[ISOCITDEH-RXN]]
-== Reaction(s) known to produce the compound ==
+* [[MALATE-DEH-RXN]]
-* [[4.1.1.81-RXN]]
+* [[MALSYN-RXN]]
-== Reaction(s) of unknown directionality ==
+* [[RXN-14971]]
-{{#set: common-name=(r)-1-amino-2-propanol o-2-phosphate}}
+* [[SUCCSEMIALDDEHYDROG-RXN]]
-{{#set: inchi-key=inchikey=ybolzujjguzudc-gsvougtgsa-m}}
+== Reaction(s) not found ==
-{{#set: molecular-weight=154.082}}
+* [NoneRXN-7774 RXN-7774]
+{{#set: taxonomic-range=tax-1224|tax-3035|tax-201174|tax-1117}}
+{{#set: common-name=tca cycle iv (2-oxoglutarate decarboxylase)}}
+{{#set: nb reaction found=10}}
+{{#set: completion rate=0.91}}
+{{#set: nb total reaction=11}}