Difference between revisions of "PWYQT-4476"

Revision as of 20:18, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9663 CPD-9663] ==
+== Pathway PWY-7173 ==
+* taxonomic-range:
+** tax-3803
 * common-name:
-** 2-epi-5-epi-valiolone
+** quercetin triglucoside biosynthesis
-* smiles:
+== Reaction(s) found ==
-** c(o)c1(o)(c(o)c(o)c(o)c(=o)c1)
+* [[RXN1F-462]]
-* inchi-key:
+== Reaction(s) not found ==
-** jczfnxyqgnlhdq-mvioudgnsa-n
+* [NoneRXN-14001 RXN-14001]
-* molecular-weight:
+* [NoneRXN-14000 RXN-14000]
-** 192.168
+{{#set: taxonomic-range=tax-3803}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=quercetin triglucoside biosynthesis}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=1}}
-* [[RXN-9140]]
+{{#set: completion rate=0.33}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb total reaction=3}}
-{{#set: common-name=2-epi-5-epi-valiolone}}
-{{#set: inchi-key=inchikey=jczfnxyqgnlhdq-mvioudgnsa-n}}
-{{#set: molecular-weight=192.168}}