Difference between revisions of "PWY-6366"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13398 CPD-13398] == * common-name: ** l-alanyl-l-leucine * smiles: ** cc(c)cc(c([o-])=o)nc(...")
(Created page with "Category:pathway == Pathway PWY-6802 == * taxonomic-range: ** tax-33090 * common-name: ** salidroside biosynthesis == Reaction(s) found == * RXN-5821 * RXN3O-4113...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13398 CPD-13398] ==
+
== Pathway PWY-6802 ==
 +
* taxonomic-range:
 +
** tax-33090
 
* common-name:
 
* common-name:
** l-alanyl-l-leucine
+
** salidroside biosynthesis
* smiles:
+
== Reaction(s) found ==
** cc(c)cc(c([o-])=o)nc(c(c)[n+])=o
+
* [[RXN-5821]]
* inchi-key:
+
* [[RXN3O-4113]]
** rdikfprvljlmer-bqbzgakwsa-n
+
* [[TYROSINE-DECARBOXYLASE-RXN]]
* molecular-weight:
+
== Reaction(s) not found ==
** 202.253
+
* [NoneRXN-12370 RXN-12370]
== Reaction(s) known to consume the compound ==
+
{{#set: taxonomic-range=tax-33090}}
* [[RXN0-6979]]
+
{{#set: common-name=salidroside biosynthesis}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb reaction found=3}}
== Reaction(s) of unknown directionality ==
+
{{#set: completion rate=0.75}}
{{#set: common-name=l-alanyl-l-leucine}}
+
{{#set: nb total reaction=4}}
{{#set: inchi-key=inchikey=rdikfprvljlmer-bqbzgakwsa-n}}
 
{{#set: molecular-weight=202.253}}
 

Revision as of 20:18, 18 December 2020

Pathway PWY-6802

  • taxonomic-range:
    • tax-33090
  • common-name:
    • salidroside biosynthesis

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-12370 RXN-12370]