Difference between revisions of "PWY-6443"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13518 CPD-13518] == * common-name: ** nω-hydroxy-l-arginine * smiles: ** c(nc(no)=[n+...")
(Created page with "Category:pathway == Pathway PWY-7546 == * taxonomic-range: ** tax-2759 * common-name: ** diphthamide biosynthesis (eukaryotes) == Reaction(s) found == * DIPHTINE--AMMONI...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13518 CPD-13518] ==
+
== Pathway PWY-7546 ==
 +
* taxonomic-range:
 +
** tax-2759
 
* common-name:
 
* common-name:
** nω-hydroxy-l-arginine
+
** diphthamide biosynthesis (eukaryotes)
* smiles:
+
== Reaction(s) found ==
** c(nc(no)=[n+])ccc([n+])c([o-])=o
+
* [[DIPHTINE--AMMONIA-LIGASE-RXN]]
* inchi-key:
+
* [[RXN-11371]]
** fqwravymzulpnk-bypyzucnsa-o
+
* [[RXN-15775]]
* molecular-weight:
+
* [[RXN-15776]]
** 191.209
+
== Reaction(s) not found ==
== Reaction(s) known to consume the compound ==
+
All reactions of this pathways are in present
* [[RXN-13565]]
+
{{#set: taxonomic-range=tax-2759}}
== Reaction(s) known to produce the compound ==
+
{{#set: common-name=diphthamide biosynthesis (eukaryotes)}}
* [[RXN-13564]]
+
{{#set: nb reaction found=4}}
== Reaction(s) of unknown directionality ==
+
{{#set: completion rate=1.0}}
{{#set: common-name=nω-hydroxy-l-arginine}}
+
{{#set: nb total reaction=4}}
{{#set: inchi-key=inchikey=fqwravymzulpnk-bypyzucnsa-o}}
 
{{#set: molecular-weight=191.209}}
 

Revision as of 20:18, 18 December 2020

Pathway PWY-7546

  • taxonomic-range:
    • tax-2759
  • common-name:
    • diphthamide biosynthesis (eukaryotes)

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present