Difference between revisions of "PWY-6632"

Revision as of 20:18, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETYL-ETCETERA-L-ASPARAGINE ACETYL-ETCETERA-L-ASPARAGINE] ==
+== Pathway PWY-6082 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** n4-(&beta;-n-acetyl-d-glucosaminyl)-l-asparagine
+** alginate biosynthesis ii (bacterial)
-* smiles:
+== Reaction(s) found ==
-** cc(=o)nc1(c(o)c(o)c(co)oc(nc(=o)cc([n+])c(=o)[o-])1)
+* [[ALGINATE-SYNTHASE-RXN]]
-* inchi-key:
+* [[GDP-MANNOSE-6-DEHYDROGENASE-RXN]]
-** yttrpbwemmpysw-hrrfrdkfsa-n
+* [[RXN-9839]]
-* molecular-weight:
+== Reaction(s) not found ==
-** 335.313
+* [NoneTRANS-RXN-270 TRANS-RXN-270]
-== Reaction(s) known to consume the compound ==
+* [NoneTRANS-RXN-269 TRANS-RXN-269]
-* [[3.5.1.26-RXN]]
+* [NoneTRANS-RXN-271 TRANS-RXN-271]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-16462 RXN-16462]
-== Reaction(s) of unknown directionality ==
+{{#set: taxonomic-range=tax-2}}
-{{#set: common-name=n4-(&beta;-n-acetyl-d-glucosaminyl)-l-asparagine}}
+{{#set: common-name=alginate biosynthesis ii (bacterial)}}
-{{#set: inchi-key=inchikey=yttrpbwemmpysw-hrrfrdkfsa-n}}
+{{#set: nb reaction found=3}}
-{{#set: molecular-weight=335.313}}
+{{#set: completion rate=0.43}}
+{{#set: nb total reaction=7}}