Difference between revisions of "PWY-6638"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13559 CPD-13559] == * common-name: ** α-d-mannopyranose * smiles: ** c(o)c1(c(o)c(o)c...")
(Created page with "Category:pathway == Pathway GLUTAMINDEG-PWY == * taxonomic-range: ** tax-2759 ** tax-2 * common-name: ** l-glutamine degradation i == Reaction(s) found == * GLUTAMIN-RXN...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13559 CPD-13559] ==
+
== Pathway GLUTAMINDEG-PWY ==
 +
* taxonomic-range:
 +
** tax-2759
 +
** tax-2
 
* common-name:
 
* common-name:
** α-d-mannopyranose
+
** l-glutamine degradation i
* smiles:
+
== Reaction(s) found ==
** c(o)c1(c(o)c(o)c(o)c(o)o1)
+
* [[GLUTAMIN-RXN]]
* inchi-key:
+
== Reaction(s) not found ==
** wqzgkkkjijffok-pqmkyfcfsa-n
+
All reactions of this pathways are in present
* molecular-weight:
+
{{#set: taxonomic-range=tax-2|tax-2759}}
** 180.157
+
{{#set: common-name=l-glutamine degradation i}}
== Reaction(s) known to consume the compound ==
+
{{#set: nb reaction found=1}}
== Reaction(s) known to produce the compound ==
+
{{#set: completion rate=1.0}}
* [[3.2.1.24-RXN]]
+
{{#set: nb total reaction=1}}
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=α-d-mannopyranose}}
 
{{#set: inchi-key=inchikey=wqzgkkkjijffok-pqmkyfcfsa-n}}
 
{{#set: molecular-weight=180.157}}
 

Revision as of 20:18, 18 December 2020

Pathway GLUTAMINDEG-PWY

  • taxonomic-range:
    • tax-2759
    • tax-2
  • common-name:
    • l-glutamine degradation i

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present