Difference between revisions of "PWY-6692"

Revision as of 20:19, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BUTYRYL-COA BUTYRYL-COA] ==
+== Pathway PWY-6559 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** butanoyl-coa
+** spermidine biosynthesis ii
-* smiles:
+== Reaction(s) found ==
-** cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+* [[ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]]
-* inchi-key:
+* [[ASPARTATEKIN-RXN]]
-** crfngmnykdxrtn-hdrjhvaisa-j
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN-11566 RXN-11566]
-** 833.593
+* [NoneRXN-11564 RXN-11564]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-2}}
-* [[ACACT2h]]
+{{#set: common-name=spermidine biosynthesis ii}}
-* [[ACOA40OR]]
+{{#set: nb reaction found=2}}
-* [[ACOAD1f]]
+{{#set: completion rate=0.5}}
-* [[RXN-12565]]
+{{#set: nb total reaction=4}}
-* [[RXN-13029]]
-== Reaction(s) known to produce the compound ==
-* [[ACOAD1f]]
-* [[ACOAR1h]]
-* [[BUTYRYL-COA-DEHYDROGENASE-RXN]]
-* [[RXN-12558]]
-* [[RXN-13029]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=butanoyl-coa}}
-{{#set: inchi-key=inchikey=crfngmnykdxrtn-hdrjhvaisa-j}}
-{{#set: molecular-weight=833.593}}