Difference between revisions of "SJ08249"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16825 CPD-16825] == * common-name: ** (s)-equol 4'-sulfate * smiles: ** c1(c=c(c=c2(occ(cc=...")
(Created page with "Category:gene == Gene SJ00591 == == Organism(s) associated with this gene == * S.japonica_sterols_curated == Reaction(s) associated == * H2Ot ** Category: ortho...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16825 CPD-16825] ==
+
== Gene SJ00591 ==
* common-name:
+
== Organism(s) associated with this gene  ==
** (s)-equol 4'-sulfate
+
* [[S.japonica_sterols_curated]]
* smiles:
+
== Reaction(s) associated ==
** c1(c=c(c=c2(occ(cc=12)c3(c=cc(=cc=3)os([o-])(=o)=o)))o)
+
* [[H2Ot]]
* inchi-key:
+
** Category: [[orthology]]
** uxojwgsgkuymia-gfccvegcsa-m
+
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
* molecular-weight:
+
* [[H2Oth]]
** 321.324
+
** Category: [[orthology]]
== Reaction(s) known to consume the compound ==
+
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
* [[RXN-15589]]
+
* [[H2Othu]]
== Reaction(s) known to produce the compound ==
+
** Category: [[orthology]]
* [[RXN-15589]]
+
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
== Reaction(s) of unknown directionality ==
+
* [[H2Otm]]
{{#set: common-name=(s)-equol 4'-sulfate}}
+
** Category: [[orthology]]
{{#set: inchi-key=inchikey=uxojwgsgkuymia-gfccvegcsa-m}}
+
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
{{#set: molecular-weight=321.324}}
+
* [[H2Otx]]
 +
** Category: [[orthology]]
 +
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=5}}

Revision as of 20:19, 18 December 2020

Gene SJ00591

Organism(s) associated with this gene

Reaction(s) associated