Difference between revisions of "SJ11692"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-OH-HYDROXYMETHYL-DIHYDROPTERIDINE AMINO-OH-HYDROXYMETHYL-DIHYDROPTERIDINE] == * common-na...")
(Created page with "Category:gene == Gene SJ05633 == * transcription-direction: ** positive * right-end-position: ** 26960 * left-end-position: ** 25202 * centisome-position: ** 28.020903...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-OH-HYDROXYMETHYL-DIHYDROPTERIDINE AMINO-OH-HYDROXYMETHYL-DIHYDROPTERIDINE] ==
+
== Gene SJ05633 ==
* common-name:
+
* transcription-direction:
** 6-(hydroxymethyl)-7,8-dihydropterin
+
** positive
* smiles:
+
* right-end-position:
** c(o)c2(=nc1(c(=o)nc(n)=nc=1nc2))
+
** 26960
* inchi-key:
+
* left-end-position:
** cqqnnqtxugluev-uhfffaoysa-n
+
** 25202
* molecular-weight:
+
* centisome-position:
** 195.18
+
** 28.020903   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[H2PTERIDINEPYROPHOSPHOKIN-RXN]]
+
* [[S.japonica_sterols_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
* [[H2NEOPTERINALDOL-RXN]]
+
* [[PROTEIN-KINASE-RXN]]
* [[RXN-10857]]
+
** Category: [[annotation]]
== Reaction(s) of unknown directionality ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: common-name=6-(hydroxymethyl)-7,8-dihydropterin}}
+
{{#set: transcription-direction=positive}}
{{#set: inchi-key=inchikey=cqqnnqtxugluev-uhfffaoysa-n}}
+
{{#set: right-end-position=26960}}
{{#set: molecular-weight=195.18}}
+
{{#set: left-end-position=25202}}
 +
{{#set: centisome-position=28.020903    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=1}}

Revision as of 20:21, 18 December 2020

Gene SJ05633

  • transcription-direction:
    • positive
  • right-end-position:
    • 26960
  • left-end-position:
    • 25202
  • centisome-position:
    • 28.020903

Organism(s) associated with this gene

Reaction(s) associated