Difference between revisions of "SJ07405"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15685 CPD-15685] == * common-name: ** 2-trans, 5-cis, 7-trans-tetradecatrienoyl-coa * smile...")
(Created page with "Category:gene == Gene SJ22654 == * transcription-direction: ** positive * right-end-position: ** 22569 * left-end-position: ** 18239 * centisome-position: ** 10.6250725...")
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15685 CPD-15685] ==
+
== Gene SJ22654 ==
−
* common-name:
+
* transcription-direction:
−
** 2-trans, 5-cis, 7-trans-tetradecatrienoyl-coa
+
** positive
−
* smiles:
+
* right-end-position:
−
** ccccccc=cc=ccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** 22569
−
* inchi-key:
+
* left-end-position:
−
** xpvhxtguzgacru-mcfmhthasa-j
+
** 18239
−
* molecular-weight:
+
* centisome-position:
−
** 967.814
+
** 10.6250725   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[RXN-14797]]
+
* [[S.japonica_sterols_curated]]
−
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
−
* [[RXN-14796]]
+
* [[2.7.10.1-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
−
{{#set: common-name=2-trans, 5-cis, 7-trans-tetradecatrienoyl-coa}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: inchi-key=inchikey=xpvhxtguzgacru-mcfmhthasa-j}}
+
* [[2.7.12.1-RXN]]
−
{{#set: molecular-weight=967.814}}
+
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[PROTEIN-KINASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[RXN-14906]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=22569}}
 +
{{#set: left-end-position=18239}}
 +
{{#set: centisome-position=10.6250725    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=4}}

Revision as of 20:21, 18 December 2020

Gene SJ22654

  • transcription-direction:
    • positive
  • right-end-position:
    • 22569
  • left-end-position:
    • 18239
  • centisome-position:
    • 10.6250725

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ07405&oldid=41726"