Difference between revisions of "CARBAMYUL-L-ASPARTATE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ02123 == * transcription-direction: ** negative * right-end-position: ** 17320 * left-end-position: ** 12475 * centisome-position: ** 8.820556...") |
(Created page with "Category:metabolite == Metabolite CPD-17370 == * common-name: ** 18-hydroxyoleoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cccccccc=ccccccccco)cop(=o)(op(=o)(occ1(...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-17370 == |
− | * | + | * common-name: |
− | ** | + | ** 18-hydroxyoleoyl-coa |
− | + | * smiles: | |
− | * | + | ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cccccccc=ccccccccco)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
− | + | * inchi-key: | |
− | ** | + | ** mqacsuxwiyyzak-utnxwdcosa-j |
− | + | * molecular-weight: | |
− | + | ** 1043.952 | |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-16117]] | |
− | = | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-16402]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=18-hydroxyoleoyl-coa}} | |
− | + | {{#set: inchi-key=inchikey=mqacsuxwiyyzak-utnxwdcosa-j}} | |
− | + | {{#set: molecular-weight=1043.952}} | |
− | |||
− | * | ||
− | |||
− | |||
− | ** | ||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | |||
− | |||
− | ** | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Revision as of 20:29, 18 December 2020
Contents
Metabolite CPD-17370
- common-name:
- 18-hydroxyoleoyl-coa
- smiles:
- cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cccccccc=ccccccccco)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- mqacsuxwiyyzak-utnxwdcosa-j
- molecular-weight:
- 1043.952