Difference between revisions of "NN-DIMETHYLANILINE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ21808 == * transcription-direction: ** negative * right-end-position: ** 170454 * left-end-position: ** 163154 * centisome-position: ** 27.60629...") |
(Created page with "Category:metabolite == Metabolite DIHYDROSIROHYDROCHLORIN == * common-name: ** precorrin-2 * smiles: ** cc5(cc(=o)[o-])(c(c4(=cc1(nc(=c(ccc(=o)[o-])c(cc(=o)[o-])=1)cc2(=c(...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite DIHYDROSIROHYDROCHLORIN == |
| − | * | + | * common-name: |
| − | ** | + | ** precorrin-2 |
| − | * | + | * smiles: |
| − | ** | + | ** cc5(cc(=o)[o-])(c(c4(=cc1(nc(=c(ccc(=o)[o-])c(cc(=o)[o-])=1)cc2(=c(ccc(=o)[o-])c(cc(=o)[o-])=c(n2)c=c3(c(c)(cc(=o)[o-])c(ccc(=o)[o-])c(=n3)c=c([n+]4)5)))))ccc(=o)[o-]) |
| − | * | + | * inchi-key: |
| − | ** | + | ** oqiiyzqttmkfau-znloqlqnsa-g |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 857.803 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[DIMETHUROPORDEHYDROG-RXN]] |
| − | == Reaction(s) | + | * [[RXN-8759]] |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | * | + | * [[RXN-13403]] |
| − | + | * [[RXN-8675]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=precorrin-2}} | |
| − | {{#set: | + | {{#set: inchi-key=inchikey=oqiiyzqttmkfau-znloqlqnsa-g}} |
| − | {{#set: | + | {{#set: molecular-weight=857.803}} |
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
Revision as of 20:29, 18 December 2020
Contents
Metabolite DIHYDROSIROHYDROCHLORIN
- common-name:
- precorrin-2
- smiles:
- cc5(cc(=o)[o-])(c(c4(=cc1(nc(=c(ccc(=o)[o-])c(cc(=o)[o-])=1)cc2(=c(ccc(=o)[o-])c(cc(=o)[o-])=c(n2)c=c3(c(c)(cc(=o)[o-])c(ccc(=o)[o-])c(=n3)c=c([n+]4)5)))))ccc(=o)[o-])
- inchi-key:
- oqiiyzqttmkfau-znloqlqnsa-g
- molecular-weight:
- 857.803
