Difference between revisions of "3-HYDROXY-L-KYNURENINE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ08012 == * transcription-direction: ** positive * right-end-position: ** 23346 * left-end-position: ** 2755 * centisome-position: ** 4.6732144...") |
(Created page with "Category:metabolite == Metabolite GLUCOSAMINE-1P == * common-name: ** d-glucosamine 1-phosphate * smiles: ** c(o)c1(oc(op(=o)([o-])[o-])c([n+])c(o)c(o)1) * inchi-key: ** y...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite GLUCOSAMINE-1P == |
− | * | + | * common-name: |
− | ** | + | ** d-glucosamine 1-phosphate |
− | * | + | * smiles: |
− | ** | + | ** c(o)c1(oc(op(=o)([o-])[o-])c([n+])c(o)c(o)1) |
− | * | + | * inchi-key: |
− | ** | + | ** ymjbyrvfgyxulk-qzabapfnsa-m |
− | * | + | * molecular-weight: |
− | ** | + | ** 258.144 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[2.3.1.157-RXN]] |
− | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=d-glucosamine 1-phosphate}} | |
− | + | {{#set: inchi-key=inchikey=ymjbyrvfgyxulk-qzabapfnsa-m}} | |
− | == | + | {{#set: molecular-weight=258.144}} |
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Revision as of 20:30, 18 December 2020
Contents
Metabolite GLUCOSAMINE-1P
- common-name:
- d-glucosamine 1-phosphate
- smiles:
- c(o)c1(oc(op(=o)([o-])[o-])c([n+])c(o)c(o)1)
- inchi-key:
- ymjbyrvfgyxulk-qzabapfnsa-m
- molecular-weight:
- 258.144