Difference between revisions of "CPD0-2350"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ18708 == * transcription-direction: ** positive * right-end-position: ** 122955 * left-end-position: ** 121056 * centisome-position: ** 50.721504...") |
(Created page with "Category:metabolite == Metabolite FERULIC-ACID == * common-name: ** ferulate * smiles: ** coc1(=cc(c=cc([o-])=o)=cc=c(o)1) * inchi-key: ** ksebmyqbyztdhs-hwkanzrosa-m * mo...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite FERULIC-ACID == |
− | * | + | * common-name: |
− | ** | + | ** ferulate |
− | * | + | * smiles: |
− | ** | + | ** coc1(=cc(c=cc([o-])=o)=cc=c(o)1) |
− | * | + | * inchi-key: |
− | ** | + | ** ksebmyqbyztdhs-hwkanzrosa-m |
− | * | + | * molecular-weight: |
− | ** | + | ** 193.179 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[6.2.1.34-RXN]] |
− | == Reaction(s) | + | * [[RXN-1121]] |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | * | + | * [[3.1.1.73-RXN]] |
− | + | * [[RXN-1104]] | |
− | {{#set: | + | == Reaction(s) of unknown directionality == |
− | {{#set: | + | {{#set: common-name=ferulate}} |
− | + | {{#set: inchi-key=inchikey=ksebmyqbyztdhs-hwkanzrosa-m}} | |
− | {{#set: | + | {{#set: molecular-weight=193.179}} |
− | |||
− |
Revision as of 20:30, 18 December 2020
Contents
Metabolite FERULIC-ACID
- common-name:
- ferulate
- smiles:
- coc1(=cc(c=cc([o-])=o)=cc=c(o)1)
- inchi-key:
- ksebmyqbyztdhs-hwkanzrosa-m
- molecular-weight:
- 193.179