Difference between revisions of "COPROPORPHYRINOGEN I"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ20898 == * transcription-direction: ** positive * right-end-position: ** 516561 * left-end-position: ** 509996 * centisome-position: ** 83.537704...") |
(Created page with "Category:metabolite == Metabolite CPD-396 == * common-name: ** 1-methylnicotinamide * smiles: ** c[n+]1(=cc=cc(=c1)c(=o)n) * inchi-key: ** ldhmavipbrsvrg-uhfffaoysa-o * mo...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-396 == |
− | * | + | * common-name: |
− | ** | + | ** 1-methylnicotinamide |
− | * | + | * smiles: |
− | ** | + | ** c[n+]1(=cc=cc(=c1)c(=o)n) |
− | * | + | * inchi-key: |
− | ** | + | ** ldhmavipbrsvrg-uhfffaoysa-o |
− | * | + | * molecular-weight: |
− | ** | + | ** 137.161 |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | == Reaction(s) | + | * [[NICOTINAMIDE-N-METHYLTRANSFERASE-RXN]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=1-methylnicotinamide}} | |
− | + | {{#set: inchi-key=inchikey=ldhmavipbrsvrg-uhfffaoysa-o}} | |
− | + | {{#set: molecular-weight=137.161}} | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Revision as of 20:30, 18 December 2020
Contents
Metabolite CPD-396
- common-name:
- 1-methylnicotinamide
- smiles:
- c[n+]1(=cc=cc(=c1)c(=o)n)
- inchi-key:
- ldhmavipbrsvrg-uhfffaoysa-o
- molecular-weight:
- 137.161