Difference between revisions of "CPD-7035"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ03419 == * transcription-direction: ** positive * right-end-position: ** 61954 * left-end-position: ** 47501 * centisome-position: ** 39.162838...")
(Created page with "Category:metabolite == Metabolite CPD0-2231 == * common-name: ** didp * smiles: ** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc=nc=23))) * inchi-key: ** bk...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ03419 ==
+
== Metabolite CPD0-2231 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** didp
−
* right-end-position:
+
* smiles:
−
** 61954
+
** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc=nc=23)))
−
* left-end-position:
+
* inchi-key:
−
** 47501
+
** bkusikgspsfqac-rrkcrqdmsa-k
−
* centisome-position:
+
* molecular-weight:
−
** 39.162838   
+
** 409.165
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-14228]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
+
* [[RXN-14228]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=didp}}
−
** Category: [[orthology]]
+
{{#set: inchi-key=inchikey=bkusikgspsfqac-rrkcrqdmsa-k}}
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=409.165}}
−
== Pathway(s) associated ==
 
−
* [[UDPNACETYLGALSYN-PWY]]
 
−
** '''3''' reactions found over '''6''' reactions in the full pathway
 
−
* [[UDPNAGSYN-PWY]]
 
−
** '''4''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PWY-6749]]
 
−
** '''1''' reactions found over '''10''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=61954}}
 
−
{{#set: left-end-position=47501}}
 
−
{{#set: centisome-position=39.162838    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=1}}
 
−
{{#set: nb pathway associated=3}}
 

Revision as of 20:30, 18 December 2020

Metabolite CPD0-2231

  • common-name:
    • didp
  • smiles:
    • c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc=nc=23)))
  • inchi-key:
    • bkusikgspsfqac-rrkcrqdmsa-k
  • molecular-weight:
    • 409.165

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-7035&oldid=45677"