Difference between revisions of "A-pyruvate-dehydrogenase-E2-protein-Nsup"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ16040 == * transcription-direction: ** negative * right-end-position: ** 563218 * left-end-position: ** 555961 * centisome-position: ** 80.3973...")
(Created page with "Category:metabolite == Metabolite CPD-16953 == * common-name: ** 2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin * smiles: ** cc2(c(c(c)o)=nc1(c(=o)nc(n)=nc=1n2)) *...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ16040 ==
+
== Metabolite CPD-16953 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** 2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin
−
* right-end-position:
+
* smiles:
−
** 563218
+
** cc2(c(c(c)o)=nc1(c(=o)nc(n)=nc=1n2))
−
* left-end-position:
+
* inchi-key:
−
** 555961
+
** ghrbcdhnysufrn-iuyqgcfvsa-n
−
* centisome-position:
+
* molecular-weight:
−
** 80.3973   
+
** 223.234
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-15733]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[PROTEIN-KINASE-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=ghrbcdhnysufrn-iuyqgcfvsa-n}}
−
** Category: [[orthology]]
+
{{#set: molecular-weight=223.234}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=563218}}
 
−
{{#set: left-end-position=555961}}
 
−
{{#set: centisome-position=80.3973    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=1}}
 

Revision as of 20:30, 18 December 2020

Metabolite CPD-16953

  • common-name:
    • 2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin
  • smiles:
    • cc2(c(c(c)o)=nc1(c(=o)nc(n)=nc=1n2))
  • inchi-key:
    • ghrbcdhnysufrn-iuyqgcfvsa-n
  • molecular-weight:
    • 223.234

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.


Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=A-pyruvate-dehydrogenase-E2-protein-Nsup&oldid=45758"