Difference between revisions of "3-7-DIMETHYLXANTHINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ11151 == * transcription-direction: ** negative * right-end-position: ** 303991 * left-end-position: ** 298300 * centisome-position: ** 78.86318...")
(Created page with "Category:metabolite == Metabolite GLUTACONYL-COA == * common-name: ** (e)-glutaconyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(c=ccc(=o)[o-])=o)cop(=o)(op(=o)(occ1(c(o...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ11151 ==
+
== Metabolite GLUTACONYL-COA ==
* transcription-direction:
+
* common-name:
** negative
+
** (e)-glutaconyl-coa
* right-end-position:
+
* smiles:
** 303991
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(c=ccc(=o)[o-])=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
* left-end-position:
+
* inchi-key:
** 298300
+
** urtlotisfjppou-degqqwijsa-i
* centisome-position:
+
* molecular-weight:
** 78.86318   
+
** 874.579
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[GLUTACONYL-COA-DECARBOXYLASE-RXN]]
== Reaction(s) associated ==
+
* [[GLUTARYL-COA-DEHYDROG-RXN]]
* [[3.4.22.68-RXN]]
+
== Reaction(s) known to produce the compound ==
** Category: [[annotation]]
+
* [[GLUTACONYL-COA-DECARBOXYLASE-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[GLUTARYL-COA-DEHYDROG-RXN]]
{{#set: transcription-direction=negative}}
+
== Reaction(s) of unknown directionality ==
{{#set: right-end-position=303991}}
+
{{#set: common-name=(e)-glutaconyl-coa}}
{{#set: left-end-position=298300}}
+
{{#set: inchi-key=inchikey=urtlotisfjppou-degqqwijsa-i}}
{{#set: centisome-position=78.86318    }}
+
{{#set: molecular-weight=874.579}}
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 

Revision as of 20:30, 18 December 2020

Metabolite GLUTACONYL-COA

  • common-name:
    • (e)-glutaconyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(c=ccc(=o)[o-])=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • urtlotisfjppou-degqqwijsa-i
  • molecular-weight:
    • 874.579

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality