Difference between revisions of "3-7-DIMETHYLXANTHINE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ11151 == * transcription-direction: ** negative * right-end-position: ** 303991 * left-end-position: ** 298300 * centisome-position: ** 78.86318...") |
(Created page with "Category:metabolite == Metabolite GLUTACONYL-COA == * common-name: ** (e)-glutaconyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(c=ccc(=o)[o-])=o)cop(=o)(op(=o)(occ1(c(o...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite GLUTACONYL-COA == |
− | * | + | * common-name: |
− | ** | + | ** (e)-glutaconyl-coa |
− | * | + | * smiles: |
− | ** | + | ** cc(c)(c(o)c(=o)nccc(=o)nccsc(c=ccc(=o)[o-])=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
− | * | + | * inchi-key: |
− | ** | + | ** urtlotisfjppou-degqqwijsa-i |
− | * | + | * molecular-weight: |
− | ** | + | ** 874.579 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[GLUTACONYL-COA-DECARBOXYLASE-RXN]] |
− | == Reaction(s) | + | * [[GLUTARYL-COA-DEHYDROG-RXN]] |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | * | + | * [[GLUTACONYL-COA-DECARBOXYLASE-RXN]] |
− | + | * [[GLUTARYL-COA-DEHYDROG-RXN]] | |
− | {{#set: | + | == Reaction(s) of unknown directionality == |
− | {{#set: | + | {{#set: common-name=(e)-glutaconyl-coa}} |
− | + | {{#set: inchi-key=inchikey=urtlotisfjppou-degqqwijsa-i}} | |
− | {{#set: | + | {{#set: molecular-weight=874.579}} |
− | |||
− |
Revision as of 20:30, 18 December 2020
Contents
Metabolite GLUTACONYL-COA
- common-name:
- (e)-glutaconyl-coa
- smiles:
- cc(c)(c(o)c(=o)nccc(=o)nccsc(c=ccc(=o)[o-])=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- urtlotisfjppou-degqqwijsa-i
- molecular-weight:
- 874.579