Difference between revisions of "Oxidized-flavodoxins"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ20688 == * transcription-direction: ** positive * right-end-position: ** 197235 * left-end-position: ** 177813 * centisome-position: ** 86.832085...") |
(Created page with "Category:metabolite == Metabolite CPD-13025 == * common-name: ** guanosine 2'-monophosphate * smiles: ** c(o)c1(oc(c(op([o-])(=o)[o-])c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) *...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-13025 == |
| − | * | + | * common-name: |
| − | ** | + | ** guanosine 2'-monophosphate |
| − | * | + | * smiles: |
| − | ** | + | ** c(o)c1(oc(c(op([o-])(=o)[o-])c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) |
| − | * | + | * inchi-key: |
| − | ** | + | ** wtifiazwccbcge-uuokfmhzsa-l |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 361.207 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == Reaction(s) | + | * [[RXN-12058]] |
| − | * [[ | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=guanosine 2'-monophosphate}} | |
| − | + | {{#set: inchi-key=inchikey=wtifiazwccbcge-uuokfmhzsa-l}} | |
| − | == | + | {{#set: molecular-weight=361.207}} |
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Revision as of 20:31, 18 December 2020
Contents
Metabolite CPD-13025
- common-name:
- guanosine 2'-monophosphate
- smiles:
- c(o)c1(oc(c(op([o-])(=o)[o-])c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
- inchi-key:
- wtifiazwccbcge-uuokfmhzsa-l
- molecular-weight:
- 361.207
