Difference between revisions of "1-Alkyl-sn-glycero-3-phosphocholines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ16939 == * transcription-direction: ** positive * right-end-position: ** 370130 * left-end-position: ** 356124 * centisome-position: ** 52.217365...")
(Created page with "Category:metabolite == Metabolite ACRYLYL-COA == * common-name: ** acryloyl-coa * smiles: ** c=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ16939 ==
+
== Metabolite ACRYLYL-COA ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** acryloyl-coa
−
* right-end-position:
+
* smiles:
−
** 370130
+
** c=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
−
* left-end-position:
+
* inchi-key:
−
** 356124
+
** poodsgumucvrtr-iexphmlfsa-j
−
* centisome-position:
+
* molecular-weight:
−
** 52.217365   
+
** 817.551
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[PPCOAOm]]
−
== Reaction(s) associated ==
+
* [[RXN-6383]]
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) known to produce the compound ==
−
* [[3.4.11.18-RXN]]
+
* [[PPCOAOm]]
−
** Category: [[annotation]]
+
* [[RXN-6383]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
** Category: [[orthology]]
+
{{#set: common-name=acryloyl-coa}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: inchi-key=inchikey=poodsgumucvrtr-iexphmlfsa-j}}
−
* [[RXN-17873]]
+
{{#set: molecular-weight=817.551}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-17874]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-17875]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-17876]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-17877]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-17878]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
</div>
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7800]]
 
−
** '''6''' reactions found over '''21''' reactions in the full pathway
 
−
* [[PWY-7799]]
 
−
** '''7''' reactions found over '''14''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=370130}}
 
−
{{#set: left-end-position=356124}}
 
−
{{#set: centisome-position=52.217365    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=7}}
 
−
{{#set: nb pathway associated=2}}
 

Revision as of 20:31, 18 December 2020

Metabolite ACRYLYL-COA

  • common-name:
    • acryloyl-coa
  • smiles:
    • c=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • poodsgumucvrtr-iexphmlfsa-j
  • molecular-weight:
    • 817.551

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=1-Alkyl-sn-glycero-3-phosphocholines&oldid=46026"