Difference between revisions of "HEPARIN-GLUCOSAMINE-3-O-SULFATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ10325 == * transcription-direction: ** negative * right-end-position: ** 268789 * left-end-position: ** 257558 * centisome-position: ** 65.60633...")
(Created page with "Category:metabolite == Metabolite CPD-11412 == * common-name: ** triiodothyroacetate ester glucuronide * smiles: ** c(oc1(c(o)c(o)c(o)c(c(=o)[o-])o1))(=o)cc2(c=c(i)c(=c(i)...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ10325 ==
+
== Metabolite CPD-11412 ==
* transcription-direction:
+
* common-name:
** negative
+
** triiodothyroacetate ester glucuronide
* right-end-position:
+
* smiles:
** 268789
+
** c(oc1(c(o)c(o)c(o)c(c(=o)[o-])o1))(=o)cc2(c=c(i)c(=c(i)c=2)oc3(=cc(i)=c(o)c=c3))
* left-end-position:
+
* inchi-key:
** 257558
+
** fpejnmnxcsitjo-kfyubchvsa-m
* centisome-position:
+
* molecular-weight:
** 65.60633   
+
** 797.054
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
== Reaction(s) associated ==
+
* [[RXN-10618]]
* [[PROTEIN-KINASE-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=triiodothyroacetate ester glucuronide}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=fpejnmnxcsitjo-kfyubchvsa-m}}
** Category: [[orthology]]
+
{{#set: molecular-weight=797.054}}
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=268789}}
 
{{#set: left-end-position=257558}}
 
{{#set: centisome-position=65.60633    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 

Revision as of 20:31, 18 December 2020

Metabolite CPD-11412

  • common-name:
    • triiodothyroacetate ester glucuronide
  • smiles:
    • c(oc1(c(o)c(o)c(o)c(c(=o)[o-])o1))(=o)cc2(c=c(i)c(=c(i)c=2)oc3(=cc(i)=c(o)c=c3))
  • inchi-key:
    • fpejnmnxcsitjo-kfyubchvsa-m
  • molecular-weight:
    • 797.054

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality