Difference between revisions of "CPD-8678"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ11348 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == <div class="toccolours mw-co...") |
(Created page with "Category:metabolite == Metabolite 5Z13E-15S-9-ALPHA11-ALPHA15-TRIHY == * common-name: ** prostaglandin f2α * smiles: ** cccccc(o)c=cc1(c(o)cc(o)c(cc=ccccc(=o)[o-])1)...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite 5Z13E-15S-9-ALPHA11-ALPHA15-TRIHY == |
− | + | * common-name: | |
− | + | ** prostaglandin f2α | |
− | + | * smiles: | |
− | + | ** cccccc(o)c=cc1(c(o)cc(o)c(cc=ccccc(=o)[o-])1) | |
− | + | * inchi-key: | |
− | + | ** pxgpltodnuvgfl-ynnpmvkqsa-m | |
− | + | * molecular-weight: | |
− | + | ** 353.478 | |
− | + | == Reaction(s) known to consume the compound == | |
− | + | * [[1.1.1.188-RXN]] | |
− | + | * [[PROSTAGLANDIN-E2-9-REDUCTASE-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[1.1.1.188-RXN]] | |
− | * | + | * [[PROSTAGLANDIN-E2-9-REDUCTASE-RXN]] |
− | + | == Reaction(s) of unknown directionality == | |
− | ** | + | {{#set: common-name=prostaglandin f2α}} |
− | + | {{#set: inchi-key=inchikey=pxgpltodnuvgfl-ynnpmvkqsa-m}} | |
− | * | + | {{#set: molecular-weight=353.478}} |
− | ** | ||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | ** | ||
− | |||
− | * | ||
− | ** | ||
− | |||
− | == | ||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | {{#set: |
Revision as of 20:31, 18 December 2020
Contents
Metabolite 5Z13E-15S-9-ALPHA11-ALPHA15-TRIHY
- common-name:
- prostaglandin f2α
- smiles:
- cccccc(o)c=cc1(c(o)cc(o)c(cc=ccccc(=o)[o-])1)
- inchi-key:
- pxgpltodnuvgfl-ynnpmvkqsa-m
- molecular-weight:
- 353.478