Difference between revisions of "CPD-8678"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ11348 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == <div class="toccolours mw-co...")
(Created page with "Category:metabolite == Metabolite 5Z13E-15S-9-ALPHA11-ALPHA15-TRIHY == * common-name: ** prostaglandin f2α * smiles: ** cccccc(o)c=cc1(c(o)cc(o)c(cc=ccccc(=o)[o-])1)...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ11348 ==
+
== Metabolite 5Z13E-15S-9-ALPHA11-ALPHA15-TRIHY ==
−
== Organism(s) associated with this gene  ==
+
* common-name:
−
* [[S.japonica_carotenoid_curated]]
+
** prostaglandin f2&alpha;
−
== Reaction(s) associated ==
+
* smiles:
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
** cccccc(o)c=cc1(c(o)cc(o)c(cc=ccccc(=o)[o-])1)
−
* [[1.14.13.78-RXN]]
+
* inchi-key:
−
** Category: [[orthology]]
+
** pxgpltodnuvgfl-ynnpmvkqsa-m
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
* molecular-weight:
−
* [[RXN-1121]]
+
** 353.478
−
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
* [[1.1.1.188-RXN]]
−
* [[RXN-12510]]
+
* [[PROSTAGLANDIN-E2-9-REDUCTASE-RXN]]
−
** Category: [[orthology]]
+
== Reaction(s) known to produce the compound ==
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
* [[1.1.1.188-RXN]]
−
* [[RXN-3661]]
+
* [[PROSTAGLANDIN-E2-9-REDUCTASE-RXN]]
−
** Category: [[orthology]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
{{#set: common-name=prostaglandin f2&alpha;}}
−
* [[RXN-5242]]
+
{{#set: inchi-key=inchikey=pxgpltodnuvgfl-ynnpmvkqsa-m}}
−
** Category: [[orthology]]
+
{{#set: molecular-weight=353.478}}
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-7580]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-7651]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
* [[TRANS-CINNAMATE-4-MONOOXYGENASE-RXN]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
</div>
 
−
== Pathway(s) associated ==
 
−
* [[PWY-5047]]
 
−
** '''6''' reactions found over '''15''' reactions in the full pathway
 
−
* [[PWY-5034]]
 
−
** '''6''' reactions found over '''6''' reactions in the full pathway
 
−
* [[PWY-2181]]
 
−
** '''3''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-3101]]
 
−
** '''4''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-5640]]
 
−
** '''1''' reactions found over '''1''' reactions in the full pathway
 
−
* [[PWY-5060]]
 
−
** '''1''' reactions found over '''6''' reactions in the full pathway
 
−
* [[PWY1F-467]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-1121]]
 
−
** '''9''' reactions found over '''19''' reactions in the full pathway
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=8}}
 
−
{{#set: nb pathway associated=8}}
 

Revision as of 20:31, 18 December 2020

Metabolite 5Z13E-15S-9-ALPHA11-ALPHA15-TRIHY

  • common-name:
    • prostaglandin f2α
  • smiles:
    • cccccc(o)c=cc1(c(o)cc(o)c(cc=ccccc(=o)[o-])1)
  • inchi-key:
    • pxgpltodnuvgfl-ynnpmvkqsa-m
  • molecular-weight:
    • 353.478

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-8678&oldid=46106"