Difference between revisions of "2-3-DIHYDROXYBENZOATE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ17133 == * transcription-direction: ** positive * right-end-position: ** 109502 * left-end-position: ** 97518 * centisome-position: ** 36.066216...") |
(Created page with "Category:metabolite == Metabolite CPD-7003 == * common-name: ** tetrahydrogeranylgeranyl diphosphate * smiles: ** cc(=cccc(cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-7003 == |
− | * | + | * common-name: |
− | ** | + | ** tetrahydrogeranylgeranyl diphosphate |
− | * | + | * smiles: |
− | ** | + | ** cc(=cccc(cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c |
− | + | * inchi-key: | |
− | + | ** vzbgwadxujsbti-pyddkjgssa-k | |
− | + | * molecular-weight: | |
− | + | ** 451.456 | |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-7659]] | |
− | = | + | * [[RXN-7660]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-7659]] | |
− | + | * [[RXN-7660]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=tetrahydrogeranylgeranyl diphosphate}} | |
− | + | {{#set: inchi-key=inchikey=vzbgwadxujsbti-pyddkjgssa-k}} | |
− | * | + | {{#set: molecular-weight=451.456}} |
− | |||
− | |||
− | ** | ||
− | |||
− | * | ||
− | |||
− | |||
− | |||
− | ** | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Revision as of 20:31, 18 December 2020
Contents
Metabolite CPD-7003
- common-name:
- tetrahydrogeranylgeranyl diphosphate
- smiles:
- cc(=cccc(cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c
- inchi-key:
- vzbgwadxujsbti-pyddkjgssa-k
- molecular-weight:
- 451.456