Difference between revisions of "CPD-706"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ10996 == * transcription-direction: ** negative * right-end-position: ** 1086183 * left-end-position: ** 1080311 * centisome-position: ** 74.78897...")
(Created page with "Category:metabolite == Metabolite IMP == * common-name: ** imp * smiles: ** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23))) * inchi-key: ** grszfwquakgdav-kqy...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ10996 ==
+
== Metabolite IMP ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** imp
−
* right-end-position:
+
* smiles:
−
** 1086183
+
** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23)))
−
* left-end-position:
+
* inchi-key:
−
** 1080311
+
** grszfwquakgdav-kqynxxcusa-l
−
* centisome-position:
+
* molecular-weight:
−
** 74.78897   
+
** 346.193
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[ADENYLOSUCCINATE-SYNTHASE-RXN]]
−
== Reaction(s) associated ==
+
* [[HPRT]]
−
* [[ADDALT-RXN]]
+
* [[I5NT]]
−
** Category: [[annotation]]
+
* [[IMP-DEHYDROG-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[IMPCYCLOHYDROLASE-RXN]]
−
** Category: [[orthology]]
+
* [[RXN-7607]]
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[ADENODEAMIN-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
 
* [[AMP-DEAMINASE-RXN]]
 
* [[AMP-DEAMINASE-RXN]]
−
** Category: [[orthology]]
+
* [[GMP-REDUCT-RXN]]
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[HPRT]]
−
== Pathway(s) associated ==
+
* [[HYPOXANPRIBOSYLTRAN-RXN]]
−
* [[PWY-7179-1]]
+
* [[IMP-DEHYDROG-RXN]]
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
* [[IMPCYCLOHYDROLASE-RXN]]
−
* [[PWY-7179]]
+
* [[ITPP]]
−
** '''4''' reactions found over '''4''' reactions in the full pathway
+
* [[RXN-14003]]
−
* [[PWY-6611]]
+
* [[RXN0-6382]]
−
** '''2''' reactions found over '''3''' reactions in the full pathway
+
== Reaction(s) of unknown directionality ==
−
* [[SALVADEHYPOX-PWY]]
+
{{#set: common-name=imp}}
−
** '''5''' reactions found over '''5''' reactions in the full pathway
+
{{#set: inchi-key=inchikey=grszfwquakgdav-kqynxxcusa-l}}
−
* [[PWY-6609]]
+
{{#set: molecular-weight=346.193}}
−
** '''4''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY0-1296]]
 
−
** '''6''' reactions found over '''6''' reactions in the full pathway
 
−
* [[PWY-6596]]
 
−
** '''7''' reactions found over '''8''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=1086183}}
 
−
{{#set: left-end-position=1080311}}
 
−
{{#set: centisome-position=74.78897    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=3}}
 
−
{{#set: nb pathway associated=7}}
 

Revision as of 20:31, 18 December 2020

Metabolite IMP

  • common-name:
    • imp
  • smiles:
    • c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23)))
  • inchi-key:
    • grszfwquakgdav-kqynxxcusa-l
  • molecular-weight:
    • 346.193

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-706&oldid=46121"