Difference between revisions of "CPD-1301"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ07257 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 4.2.2.10-RXN ** Catego...") |
(Created page with "Category:metabolite == Metabolite P-NITROPHENOL == * common-name: ** 4-nitrophenol * smiles: ** c1(c=c([o-])c=cc=1[n+](=o)[o-]) * inchi-key: ** btjiuguipkrlhp-uhfffaoysa-m...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite P-NITROPHENOL == |
| − | = | + | * common-name: |
| − | * | + | ** 4-nitrophenol |
| − | == Reaction(s) | + | * smiles: |
| − | * [[4 | + | ** c1(c=c([o-])c=cc=1[n+](=o)[o-]) |
| − | * | + | * inchi-key: |
| − | * | + | ** btjiuguipkrlhp-uhfffaoysa-m |
| − | * [[RXN- | + | * molecular-weight: |
| − | * | + | ** 138.102 |
| − | + | == Reaction(s) known to consume the compound == | |
| − | == | + | == Reaction(s) known to produce the compound == |
| − | + | * [[4-NITROPHENYLPHOSPHATASE-RXN]] | |
| − | + | * [[ARYLDIALKYL-PHOSPHATASE-RXN]] | |
| − | {{#set: | + | * [[RXN-17830]] |
| − | {{#set: | + | * [[RXN-8743]] |
| − | {{#set: | + | * [[RXN-8746]] |
| + | == Reaction(s) of unknown directionality == | ||
| + | {{#set: common-name=4-nitrophenol}} | ||
| + | {{#set: inchi-key=inchikey=btjiuguipkrlhp-uhfffaoysa-m}} | ||
| + | {{#set: molecular-weight=138.102}} | ||
Revision as of 20:31, 18 December 2020
Contents
Metabolite P-NITROPHENOL
- common-name:
- 4-nitrophenol
- smiles:
- c1(c=c([o-])c=cc=1[n+](=o)[o-])
- inchi-key:
- btjiuguipkrlhp-uhfffaoysa-m
- molecular-weight:
- 138.102
