Difference between revisions of "CPD-1130"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ04970 == * transcription-direction: ** negative * right-end-position: ** 442527 * left-end-position: ** 425133 * centisome-position: ** 44.02631...")
(Created page with "Category:metabolite == Metabolite CPD-17264 == * common-name: ** (2e,8z,11z,14z,17z)-icosa-2,8,11,14,17-pentaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=cccccc=cc(=o)sccnc(=o)c...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ04970 ==
+
== Metabolite CPD-17264 ==
* transcription-direction:
+
* common-name:
** negative
+
** (2e,8z,11z,14z,17z)-icosa-2,8,11,14,17-pentaenoyl-coa
* right-end-position:
+
* smiles:
** 442527
+
** ccc=ccc=ccc=ccc=cccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
* left-end-position:
+
* inchi-key:
** 425133
+
** ptromslvpfeiqj-qpyoymcksa-j
* centisome-position:
+
* molecular-weight:
** 44.02631   
+
** 1047.943
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
== Reaction(s) associated ==
+
* [[RXN-16021]]
* [[2.4.1.223-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=(2e,8z,11z,14z,17z)-icosa-2,8,11,14,17-pentaenoyl-coa}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=ptromslvpfeiqj-qpyoymcksa-j}}
* [[HEPARITIN-SULFOTRANSFERASE-RXN]]
+
{{#set: molecular-weight=1047.943}}
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== Pathway(s) associated ==
 
* [[PWY-6558]]
 
** '''7''' reactions found over '''13''' reactions in the full pathway
 
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=442527}}
 
{{#set: left-end-position=425133}}
 
{{#set: centisome-position=44.02631    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=2}}
 
{{#set: nb pathway associated=1}}
 

Revision as of 20:31, 18 December 2020

Metabolite CPD-17264

  • common-name:
    • (2e,8z,11z,14z,17z)-icosa-2,8,11,14,17-pentaenoyl-coa
  • smiles:
    • ccc=ccc=ccc=ccc=cccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • ptromslvpfeiqj-qpyoymcksa-j
  • molecular-weight:
    • 1047.943

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality