Difference between revisions of "CPD-9663"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ03110 == * transcription-direction: ** positive * right-end-position: ** 88322 * left-end-position: ** 67065 * centisome-position: ** 53.603542...")
(Created page with "Category:metabolite == Metabolite L-ASPARTATE == * common-name: ** l-aspartate * smiles: ** c(c(=o)[o-])c([n+])c(=o)[o-] * inchi-key: ** ckljmwtzizzhcs-reohclbhsa-m * mole...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ03110 ==
+
== Metabolite L-ASPARTATE ==
* transcription-direction:
+
* common-name:
** positive
+
** l-aspartate
* right-end-position:
+
* smiles:
** 88322
+
** c(c(=o)[o-])c([n+])c(=o)[o-]
* left-end-position:
+
* inchi-key:
** 67065
+
** ckljmwtzizzhcs-reohclbhsa-m
* centisome-position:
+
* molecular-weight:
** 53.603542   
+
** 132.096
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[ADENYLOSUCCINATE-SYNTHASE-RXN]]
== Reaction(s) associated ==
+
* [[ARGSUCCINSYN-RXN]]
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
+
* [[ASNSYNA-RXN]]
** Category: [[annotation]]
+
* [[ASNSYNB-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[ASPAMINOTRANS-RXN]]
== Pathway(s) associated ==
+
* [[ASPARTATE--TRNA-LIGASE-RXN]]
* [[PWY-7511]]
+
* [[ASPARTATEKIN-RXN]]
** '''7''' reactions found over '''9''' reactions in the full pathway
+
* [[ASPCARBTRANS-RXN]]
{{#set: transcription-direction=positive}}
+
* [[L-ASPARTATE-OXID-RXN]]
{{#set: right-end-position=88322}}
+
* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
{{#set: left-end-position=67065}}
+
* [[QUINOLINATE-SYNTHE-MULTI-RXN]]
{{#set: centisome-position=53.603542    }}
+
* [[RXN-10]]
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
* [[RXN-13697]]
{{#set: nb reaction associated=1}}
+
* [[RXN-9772]]
{{#set: nb pathway associated=1}}
+
* [[SAICARSYN-RXN]]
 +
* [[biomass_rxn]]
 +
== Reaction(s) known to produce the compound ==
 +
* [[3.4.11.21-RXN]]
 +
* [[3.5.1.26-RXN]]
 +
* [[ASPAMINOTRANS-RXN]]
 +
* [[ASPARAGHYD-RXN]]
 +
* [[ASPARTATEKIN-RXN]]
 +
* [[ASPCARBTRANS-RXN]]
 +
* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
 +
* [[RXN-13697]]
 +
* [[RXN0-6975]]
 +
* [[RXN0-6987]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=l-aspartate}}
 +
{{#set: inchi-key=inchikey=ckljmwtzizzhcs-reohclbhsa-m}}
 +
{{#set: molecular-weight=132.096}}

Revision as of 20:31, 18 December 2020