|
|
| Line 1: |
Line 1: |
| − | [[Category:gene]] | + | [[Category:metabolite]] |
| − | == Gene SJ09771 == | + | == Metabolite 4-hydroxybenzoate == |
| − | * transcription-direction: | + | * common-name: |
| − | ** negative | + | ** 4-hydroxybenzoate |
| − | * right-end-position:
| + | * smiles: |
| − | ** 34418
| + | ** c(c1(c=cc(=cc=1)o))(=o)[o-] |
| − | * left-end-position: | + | * inchi-key: |
| − | ** 6694 | + | ** fjkrolugyxjwqn-uhfffaoysa-m |
| − | * centisome-position:
| + | * molecular-weight: |
| − | ** 1.6473727
| + | ** 137.115 |
| − | == Organism(s) associated with this gene == | + | == Reaction(s) known to consume the compound == |
| − | * [[S.japonica_carotenoid_curated]]
| + | * [[4OHBENZOATE-OCTAPRENYLTRANSFER-RXN]] |
| − | == Reaction(s) associated ==
| + | * [[RXN-9003]] |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | == Reaction(s) known to produce the compound == |
| − | * [[3-ISOPROPYLMALISOM-RXN]]
| + | == Reaction(s) of unknown directionality == |
| − | ** Category: [[annotation]]
| + | {{#set: common-name=4-hydroxybenzoate}} |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| + | {{#set: inchi-key=inchikey=fjkrolugyxjwqn-uhfffaoysa-m}} |
| − | ** Category: [[orthology]]
| + | {{#set: molecular-weight=137.115}} |
| − | *** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | *** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[HOMOACONITATE-HYDRATASE-RXN]]
| |
| − | ** Category: [[orthology]] | |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[IMDHT_LPAREN_3c2hmp_RPAREN_]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[R-2-METHYLMALATE-DEHYDRATASE-RXN]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * [[RXN-13163]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-13722]]
| |
| − | ** Category: [[orthology]] | |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXN-8991]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | |
| − | </div>
| |
| − | == Pathway(s) associated == | |
| − | * [[LEUSYN-PWY]] | |
| − | ** '''5''' reactions found over '''6''' reactions in the full pathway
| |
| − | * [[PWY-6871]]
| |
| − | ** '''5''' reactions found over '''7''' reactions in the full pathway
| |
| − | * [[LYSINE-AMINOAD-PWY]]
| |
| − | ** '''1''' reactions found over '''9''' reactions in the full pathway
| |
| − | * [[P241-PWY]] | |
| − | ** '''1''' reactions found over '''16''' reactions in the full pathway
| |
| − | * [[PWY-3081]]
| |
| − | ** '''1''' reactions found over '''10''' reactions in the full pathway
| |
| − | * [[PWY-5101]]
| |
| − | ** '''4''' reactions found over '''8''' reactions in the full pathway
| |
| − | * [[PWY-7698]]
| |
| − | ** '''1''' reactions found over '''13''' reactions in the full pathway
| |
| − | {{#set: transcription-direction=negative}} | |
| − | {{#set: right-end-position=34418}} | |
| − | {{#set: left-end-position=6694}}
| |
| − | {{#set: centisome-position=1.6473727 }} | |
| − | {{#set: organism associated=S.japonica_carotenoid_curated}}
| |
| − | {{#set: nb reaction associated=7}}
| |
| − | {{#set: nb pathway associated=7}}
| |
