Difference between revisions of "CPD-728"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ13838 == * transcription-direction: ** positive * right-end-position: ** 36590 * left-end-position: ** 35376 * centisome-position: ** 10.72403...") |
(Created page with "Category:metabolite == Metabolite THREO-DS-ISO-CITRATE == * common-name: ** d-threo-isocitrate * smiles: ** c(=o)(c(cc([o-])=o)c(o)c([o-])=o)[o-] * inchi-key: ** odblhexud...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite THREO-DS-ISO-CITRATE == |
| − | * | + | * common-name: |
| − | ** | + | ** d-threo-isocitrate |
| − | * | + | * smiles: |
| − | ** | + | ** c(=o)(c(cc([o-])=o)c(o)c([o-])=o)[o-] |
| − | * | + | * inchi-key: |
| − | ** | + | ** odblhexudapzau-zafykaaxsa-k |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 189.101 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[ACONITATEHYDR-RXN]] |
| − | + | * [[ISOCIT-CLEAV-RXN]] | |
| − | * [[ | + | * [[ISOCITDEH-RXN]] |
| − | ** | + | * [[RXN-14047]] |
| − | * | + | * [[RXN-9951]] |
| − | * [[ | + | * [[biomass_rxn]] |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | * | + | * [[ACONITATEHYDR-RXN]] |
| − | + | * [[ISOCIT-CLEAV-RXN]] | |
| − | {{#set: | + | * [[ISOCITDEH-RXN]] |
| − | + | * [[RXN-14047]] | |
| − | {{#set: | + | * [[RXN-9951]] |
| − | {{#set: | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=d-threo-isocitrate}} | |
| + | {{#set: inchi-key=inchikey=odblhexudapzau-zafykaaxsa-k}} | ||
| + | {{#set: molecular-weight=189.101}} | ||
Revision as of 20:31, 18 December 2020
Contents
Metabolite THREO-DS-ISO-CITRATE
- common-name:
- d-threo-isocitrate
- smiles:
- c(=o)(c(cc([o-])=o)c(o)c([o-])=o)[o-]
- inchi-key:
- odblhexudapzau-zafykaaxsa-k
- molecular-weight:
- 189.101
