Difference between revisions of "CIS-ACONITATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ18340 == * transcription-direction: ** negative * right-end-position: ** 152919 * left-end-position: ** 132502 * centisome-position: ** 53.309357...")
(Created page with "Category:metabolite == Metabolite RIBOSE-1P == * common-name: ** α-d-ribose-1-phosphate * smiles: ** c(o)c1(c(o)c(o)c(op(=o)([o-])[o-])o1) * inchi-key: ** yxjdfqjker...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ18340 ==
+
== Metabolite RIBOSE-1P ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** α-d-ribose-1-phosphate
−
* right-end-position:
+
* smiles:
−
** 152919
+
** c(o)c1(c(o)c(o)c(op(=o)([o-])[o-])o1)
−
* left-end-position:
+
* inchi-key:
−
** 132502
+
** yxjdfqjkerbobm-txicztdvsa-l
−
* centisome-position:
+
* molecular-weight:
−
** 53.309357   
+
** 228.095
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[ADENPHOSPHOR-RXN]]
−
== Reaction(s) associated ==
+
* [[INOPHOSPHOR-RXN]]
−
* [[CHOLINE-KINASE-RXN]]
+
* [[PNP-RXN]]
−
** Category: [[annotation]]
+
* [[PPENTOMUT-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-14456]]
−
** Category: [[orthology]]
+
* [[RXN0-5199]]
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[URPHOS-RXN]]
−
* [[ETHANOLAMINE-KINASE-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[ADENPHOSPHOR-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[INOPHOSPHOR-RXN]]
−
** Category: [[orthology]]
+
* [[PNP-RXN]]
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
* [[PPENTOMUT-RXN]]
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[RXN-14456]]
−
== Pathway(s) associated ==
+
* [[RXN0-5199]]
−
* [[PWY-7782]]
+
* [[URPHOS-RXN]]
−
** '''11''' reactions found over '''16''' reactions in the full pathway
+
* [[XANTHOSINEPHOSPHORY-RXN]]
−
* [[PWY3O-450]]
+
== Reaction(s) of unknown directionality ==
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
{{#set: common-name=α-d-ribose-1-phosphate}}
−
* [[PWY-7818]]
+
{{#set: inchi-key=inchikey=yxjdfqjkerbobm-txicztdvsa-l}}
−
** '''2''' reactions found over '''19''' reactions in the full pathway
+
{{#set: molecular-weight=228.095}}
−
* [[PWY-7886]]
 
−
** '''2''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-3385]]
 
−
** '''2''' reactions found over '''6''' reactions in the full pathway
 
−
* [[PWY4FS-6]]
 
−
** '''3''' reactions found over '''4''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=152919}}
 
−
{{#set: left-end-position=132502}}
 
−
{{#set: centisome-position=53.309357    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=6}}
 

Revision as of 20:32, 18 December 2020

Metabolite RIBOSE-1P

  • common-name:
    • α-d-ribose-1-phosphate
  • smiles:
    • c(o)c1(c(o)c(o)c(op(=o)([o-])[o-])o1)
  • inchi-key:
    • yxjdfqjkerbobm-txicztdvsa-l
  • molecular-weight:
    • 228.095

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CIS-ACONITATE&oldid=46256"