Difference between revisions of "M7G5-pppAm-mRNAs"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ18416 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * FORthi ** Category: ...") |
(Created page with "Category:metabolite == Metabolite O-UREIDOHOMOSERINE == * common-name: ** o-ureido-l-homoserine * smiles: ** c(cc(c(=o)[o-])[n+])onc(n)=o * inchi-key: ** sfyvzosiaizwqu-vk...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite O-UREIDOHOMOSERINE == |
| − | == | + | * common-name: |
| − | * [[ | + | ** o-ureido-l-homoserine |
| − | == Reaction(s) | + | * smiles: |
| − | * [[ | + | ** c(cc(c(=o)[o-])[n+])onc(n)=o |
| − | + | * inchi-key: | |
| − | + | ** sfyvzosiaizwqu-vkhmyheasa-n | |
| − | {{#set: | + | * molecular-weight: |
| − | {{#set: | + | ** 177.16 |
| + | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-10]] | ||
| + | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-9]] | ||
| + | == Reaction(s) of unknown directionality == | ||
| + | {{#set: common-name=o-ureido-l-homoserine}} | ||
| + | {{#set: inchi-key=inchikey=sfyvzosiaizwqu-vkhmyheasa-n}} | ||
| + | {{#set: molecular-weight=177.16}} | ||
Revision as of 20:32, 18 December 2020
Contents
Metabolite O-UREIDOHOMOSERINE
- common-name:
- o-ureido-l-homoserine
- smiles:
- c(cc(c(=o)[o-])[n+])onc(n)=o
- inchi-key:
- sfyvzosiaizwqu-vkhmyheasa-n
- molecular-weight:
- 177.16
