Difference between revisions of "5-BETA-L-THREO-PENTAPYRANOSYL-4-ULOSE-"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ07017 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 4.2.2.10-RXN ** Catego...") |
(Created page with "Category:metabolite == Metabolite CPD-11665 == * common-name: ** serotonin o-sulfate * smiles: ** c(n)cc1(=cnc2(=c1c=c(os(=o)(=o)o)c=c2)) * inchi-key: ** jfwysggscoobgk-uh...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-11665 == |
− | + | * common-name: | |
− | * | + | ** serotonin o-sulfate |
− | + | * smiles: | |
− | + | ** c(n)cc1(=cnc2(=c1c=c(os(=o)(=o)o)c=c2)) | |
− | + | * inchi-key: | |
− | ** | + | ** jfwysggscoobgk-uhfffaoysa-n |
− | + | * molecular-weight: | |
− | * | + | ** 256.276 |
− | ** | + | == Reaction(s) known to consume the compound == |
− | * | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-10777]] | |
− | ** | + | == Reaction(s) of unknown directionality == |
− | * | + | {{#set: common-name=serotonin o-sulfate}} |
− | + | {{#set: inchi-key=inchikey=jfwysggscoobgk-uhfffaoysa-n}} | |
− | ** | + | {{#set: molecular-weight=256.276}} |
− | == | ||
− | * [[ | ||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | {{#set: |
Revision as of 20:32, 18 December 2020
Contents
Metabolite CPD-11665
- common-name:
- serotonin o-sulfate
- smiles:
- c(n)cc1(=cnc2(=c1c=c(os(=o)(=o)o)c=c2))
- inchi-key:
- jfwysggscoobgk-uhfffaoysa-n
- molecular-weight:
- 256.276