Difference between revisions of "B-KETOACYL-ACP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ13086 == * transcription-direction: ** positive * right-end-position: ** 86153 * left-end-position: ** 58417 * centisome-position: ** 16.87694...")
(Created page with "Category:metabolite == Metabolite CPD-7158 == * common-name: ** 3-demethylubiquinol-9 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cc...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ13086 ==
+
== Metabolite CPD-7158 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** 3-demethylubiquinol-9
−
* right-end-position:
+
* smiles:
−
** 86153
+
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(c)c(o)=c(o)c(oc)=c(o)1)
−
* left-end-position:
+
* inchi-key:
−
** 58417
+
** alajatogwwbpqt-nscwjznlsa-n
−
* centisome-position:
+
* molecular-weight:
−
** 16.87694   
+
** 783.228
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[2.1.1.64-RXN]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[2.4.1.198-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=3-demethylubiquinol-9}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=alajatogwwbpqt-nscwjznlsa-n}}
−
** Category: [[orthology]]
+
{{#set: molecular-weight=783.228}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[2.4.1.223-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-6558]]
 
−
** '''7''' reactions found over '''13''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=86153}}
 
−
{{#set: left-end-position=58417}}
 
−
{{#set: centisome-position=16.87694    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=1}}
 

Revision as of 20:32, 18 December 2020

Metabolite CPD-7158

  • common-name:
    • 3-demethylubiquinol-9
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(c)c(o)=c(o)c(oc)=c(o)1)
  • inchi-key:
    • alajatogwwbpqt-nscwjznlsa-n
  • molecular-weight:
    • 783.228

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=B-KETOACYL-ACP&oldid=46404"