Difference between revisions of "ALPROSTADIL"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ22079 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 6.3.2.25-RXN ** Catego...") |
(Created page with "Category:metabolite == Metabolite ALPROSTADIL == * common-name: ** (13e)-(15s)-11-α,15-dihydroxy-9-oxoprost-13-enoate * smiles: ** cccccc(o)c=cc1(c(o)cc(=o)c(ccccccc...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite ALPROSTADIL == |
− | == | + | * common-name: |
− | * [[ | + | ** (13e)-(15s)-11-α,15-dihydroxy-9-oxoprost-13-enoate |
− | == Reaction(s) | + | * smiles: |
− | * [[ | + | ** cccccc(o)c=cc1(c(o)cc(=o)c(ccccccc(=o)[o-])1) |
− | + | * inchi-key: | |
− | + | ** gmvprgqoioiimi-dwkjamrdsa-m | |
− | {{#set: | + | * molecular-weight: |
− | {{#set: | + | ** 353.478 |
+ | == Reaction(s) known to consume the compound == | ||
+ | * [[1.1.1.197-RXN]] | ||
+ | == Reaction(s) known to produce the compound == | ||
+ | * [[1.1.1.197-RXN]] | ||
+ | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=(13e)-(15s)-11-α,15-dihydroxy-9-oxoprost-13-enoate}} | ||
+ | {{#set: inchi-key=inchikey=gmvprgqoioiimi-dwkjamrdsa-m}} | ||
+ | {{#set: molecular-weight=353.478}} |
Revision as of 20:32, 18 December 2020
Contents
Metabolite ALPROSTADIL
- common-name:
- (13e)-(15s)-11-α,15-dihydroxy-9-oxoprost-13-enoate
- smiles:
- cccccc(o)c=cc1(c(o)cc(=o)c(ccccccc(=o)[o-])1)
- inchi-key:
- gmvprgqoioiimi-dwkjamrdsa-m
- molecular-weight:
- 353.478