Difference between revisions of "DL-12-Propanediol"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ19880 == * transcription-direction: ** negative * right-end-position: ** 164633 * left-end-position: ** 152568 * centisome-position: ** 70.006195...") |
(Created page with "Category:metabolite == Metabolite UDP-4-AMINO-4-DEOXY-L-ARABINOSE == * common-name: ** udp-4-amino-4-deoxy-β-l-arabinopyranose * smiles: ** c(op(=o)([o-])op(=o)([o-])...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite UDP-4-AMINO-4-DEOXY-L-ARABINOSE == |
| − | * | + | * common-name: |
| − | ** | + | ** udp-4-amino-4-deoxy-β-l-arabinopyranose |
| − | * | + | * smiles: |
| − | ** | + | ** c(op(=o)([o-])op(=o)([o-])oc1(occ([n+])c(o)c(o)1))c2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3)) |
| − | * | + | * inchi-key: |
| − | ** | + | ** gwbakybswhqnmq-iazovdbxsa-m |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 534.286 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN0-1863]] |
| − | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
| − | * [[ | + | * [[RXN0-1863]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=udp-4-amino-4-deoxy-β-l-arabinopyranose}} | |
| − | == | + | {{#set: inchi-key=inchikey=gwbakybswhqnmq-iazovdbxsa-m}} |
| − | + | {{#set: molecular-weight=534.286}} | |
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | |||
Revision as of 20:33, 18 December 2020
Contents
Metabolite UDP-4-AMINO-4-DEOXY-L-ARABINOSE
- common-name:
- udp-4-amino-4-deoxy-β-l-arabinopyranose
- smiles:
- c(op(=o)([o-])op(=o)([o-])oc1(occ([n+])c(o)c(o)1))c2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3))
- inchi-key:
- gwbakybswhqnmq-iazovdbxsa-m
- molecular-weight:
- 534.286
