Difference between revisions of "HMP"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ03371 == * transcription-direction: ** positive * right-end-position: ** 80522 * left-end-position: ** 73478 * centisome-position: ** 60.447365...") |
(Created page with "Category:metabolite == Metabolite 4-CYTIDINE-5-DIPHOSPHO-2-C == * common-name: ** 4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol * smiles: ** cc(o)(co)c(o)cop(op([o-])(...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite 4-CYTIDINE-5-DIPHOSPHO-2-C == |
| − | * | + | * common-name: |
| − | ** | + | ** 4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol |
| − | + | * smiles: | |
| − | + | ** cc(o)(co)c(o)cop(op([o-])(=o)occ2(c(c(o)c(n1(c(n=c(c=c1)n)=o))o2)o))([o-])=o | |
| − | + | * inchi-key: | |
| − | + | ** yfaukwznpvbcff-xhibxcghsa-l | |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 519.295 |
| − | + | == Reaction(s) known to consume the compound == | |
| − | + | * [[2.7.1.148-RXN]] | |
| − | = | + | == Reaction(s) known to produce the compound == |
| − | + | * [[2.7.7.60-RXN]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol}} | |
| − | + | {{#set: inchi-key=inchikey=yfaukwznpvbcff-xhibxcghsa-l}} | |
| − | + | {{#set: molecular-weight=519.295}} | |
| − | |||
| − | * | ||
| − | |||
| − | ** | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * | ||
| − | |||
| − | ** | ||
| − | == | ||
| − | * [[ | ||
| − | |||
| − | * [[ | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | |||
Revision as of 20:33, 18 December 2020
Contents
Metabolite 4-CYTIDINE-5-DIPHOSPHO-2-C
- common-name:
- 4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol
- smiles:
- cc(o)(co)c(o)cop(op([o-])(=o)occ2(c(c(o)c(n1(c(n=c(c=c1)n)=o))o2)o))([o-])=o
- inchi-key:
- yfaukwznpvbcff-xhibxcghsa-l
- molecular-weight:
- 519.295
