Difference between revisions of "CPD-17271"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ12872 == * transcription-direction: ** positive * right-end-position: ** 328169 * left-end-position: ** 307550 * centisome-position: ** 87.843315...") |
(Created page with "Category:metabolite == Metabolite CPD-18762 == * common-name: ** 4-hydroxy-2-methyl-4-[(2e,6e)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl]quinolin-3(4h)-one 1-oxide * smiles...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-18762 == |
− | * | + | * common-name: |
− | ** | + | ** 4-hydroxy-2-methyl-4-[(2e,6e)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl]quinolin-3(4h)-one 1-oxide |
− | * | + | * smiles: |
− | ** | + | ** cc(c)=cccc(c)=cccc(c)=ccc2(o)(c(c1(c=cc=cc=1[n+](=c(c)2)[o-]))=o) |
− | * | + | * inchi-key: |
− | ** | + | ** hzbjgdkeajeslm-yefhwucqsa-n |
− | * | + | * molecular-weight: |
− | ** | + | ** 395.541 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-17334]] |
− | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=4-hydroxy-2-methyl-4-[(2e,6e)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl]quinolin-3(4h)-one 1-oxide}} | |
− | + | {{#set: inchi-key=inchikey=hzbjgdkeajeslm-yefhwucqsa-n}} | |
− | + | {{#set: molecular-weight=395.541}} | |
− | |||
− | {{#set: | ||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− |
Revision as of 20:33, 18 December 2020
Contents
Metabolite CPD-18762
- common-name:
- 4-hydroxy-2-methyl-4-[(2e,6e)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl]quinolin-3(4h)-one 1-oxide
- smiles:
- cc(c)=cccc(c)=cccc(c)=ccc2(o)(c(c1(c=cc=cc=1[n+](=c(c)2)[o-]))=o)
- inchi-key:
- hzbjgdkeajeslm-yefhwucqsa-n
- molecular-weight:
- 395.541
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "4-hydroxy-2-methyl-4-[(2e,6e)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl]quinolin-3(4h)-one 1-oxide" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.