Difference between revisions of "3-BETA-D-GLUCOSYLGLUCOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ02764 == * transcription-direction: ** negative * right-end-position: ** 68669 * left-end-position: ** 52654 * centisome-position: ** 40.788914...")
(Created page with "Category:metabolite == Metabolite CPD-15687 == * common-name: ** 5-cis, 7-trans-3-oxo-tetradecadienoyl-coa * smiles: ** ccccccc=cc=ccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ02764 ==
+
== Metabolite CPD-15687 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** 5-cis, 7-trans-3-oxo-tetradecadienoyl-coa
−
* right-end-position:
+
* smiles:
−
** 68669
+
** ccccccc=cc=ccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
−
* left-end-position:
+
* inchi-key:
−
** 52654
+
** njxbfcfhvuiemz-qtjplklfsa-j
−
* centisome-position:
+
* molecular-weight:
−
** 40.788914   
+
** 983.813
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-14799]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[PROTEIN-KINASE-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=5-cis, 7-trans-3-oxo-tetradecadienoyl-coa}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=njxbfcfhvuiemz-qtjplklfsa-j}}
−
** Category: [[orthology]]
+
{{#set: molecular-weight=983.813}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=68669}}
 
−
{{#set: left-end-position=52654}}
 
−
{{#set: centisome-position=40.788914    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=1}}
 

Revision as of 20:33, 18 December 2020

Metabolite CPD-15687

  • common-name:
    • 5-cis, 7-trans-3-oxo-tetradecadienoyl-coa
  • smiles:
    • ccccccc=cc=ccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • njxbfcfhvuiemz-qtjplklfsa-j
  • molecular-weight:
    • 983.813

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=3-BETA-D-GLUCOSYLGLUCOSE&oldid=46786"