Difference between revisions of "CPDMETA-13652"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ11771 == * transcription-direction: ** negative * right-end-position: ** 13859 * left-end-position: ** 12996 * centisome-position: ** 67.19752...") |
(Created page with "Category:metabolite == Metabolite CPD-9872 == * common-name: ** 6-methoxy-3-methyl-2-all-trans-nonaprenyl-1,4-benzoquinol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cc...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-9872 == |
− | * | + | * common-name: |
− | ** | + | ** 6-methoxy-3-methyl-2-all-trans-nonaprenyl-1,4-benzoquinol |
− | * | + | * smiles: |
− | ** | + | ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c)c)c)c)c |
− | * | + | * inchi-key: |
− | ** | + | ** glnrsjsltucxtp-iqsnhbbhsa-n |
− | * | + | * molecular-weight: |
− | ** | + | ** 767.229 |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | == Reaction(s) | + | * [[RXN-9242]] |
− | * [[ | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=6-methoxy-3-methyl-2-all-trans-nonaprenyl-1,4-benzoquinol}} | |
− | + | {{#set: inchi-key=inchikey=glnrsjsltucxtp-iqsnhbbhsa-n}} | |
− | {{#set: | + | {{#set: molecular-weight=767.229}} |
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− |
Revision as of 20:33, 18 December 2020
Contents
Metabolite CPD-9872
- common-name:
- 6-methoxy-3-methyl-2-all-trans-nonaprenyl-1,4-benzoquinol
- smiles:
- cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c)c)c)c)c
- inchi-key:
- glnrsjsltucxtp-iqsnhbbhsa-n
- molecular-weight:
- 767.229