Difference between revisions of "CPD-9872"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ07187 == * transcription-direction: ** negative * right-end-position: ** 460599 * left-end-position: ** 433716 * centisome-position: ** 29.684698...") |
(Created page with "Category:metabolite == Metabolite CPD-3709 == * common-name: ** guanosine 2',3'-cyclic monophosphate * smiles: ** c(o)c2(oc(c1(op([o-])(=o)oc12))n4(c=nc3(c(=o)nc(n)=nc=34)...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-3709 == |
| − | * | + | * common-name: |
| − | ** | + | ** guanosine 2',3'-cyclic monophosphate |
| − | * | + | * smiles: |
| − | ** | + | ** c(o)c2(oc(c1(op([o-])(=o)oc12))n4(c=nc3(c(=o)nc(n)=nc=34))) |
| − | * | + | * inchi-key: |
| − | ** | + | ** uasryodfrywbrc-uuokfmhzsa-m |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 344.2 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-12058]] |
| − | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=guanosine 2',3'-cyclic monophosphate}} | |
| − | + | {{#set: inchi-key=inchikey=uasryodfrywbrc-uuokfmhzsa-m}} | |
| − | + | {{#set: molecular-weight=344.2}} | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
Revision as of 20:33, 18 December 2020
Contents
Metabolite CPD-3709
- common-name:
- guanosine 2',3'-cyclic monophosphate
- smiles:
- c(o)c2(oc(c1(op([o-])(=o)oc12))n4(c=nc3(c(=o)nc(n)=nc=34)))
- inchi-key:
- uasryodfrywbrc-uuokfmhzsa-m
- molecular-weight:
- 344.2
