Difference between revisions of "SE-2"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ02445 == * transcription-direction: ** negative * right-end-position: ** 48420 * left-end-position: ** 46095 * centisome-position: ** 33.998127...") |
(Created page with "Category:metabolite == Metabolite CPD-15654 == * common-name: ** 2-trans, 4-cis-undecadienoyl-coa * smiles: ** ccccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-15654 == |
− | * | + | * common-name: |
− | ** | + | ** 2-trans, 4-cis-undecadienoyl-coa |
− | + | * smiles: | |
− | + | ** ccccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | |
− | + | * inchi-key: | |
− | + | ** szkpluulggerfd-nfpsboapsa-j | |
− | * | + | * molecular-weight: |
− | ** | + | ** 927.749 |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-14776]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-14775]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=2-trans, 4-cis-undecadienoyl-coa}} | |
− | + | {{#set: inchi-key=inchikey=szkpluulggerfd-nfpsboapsa-j}} | |
− | + | {{#set: molecular-weight=927.749}} | |
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | |||
− | ** | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | |||
− | ** | ||
− | |||
− | == | ||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− |
Revision as of 20:33, 18 December 2020
Contents
Metabolite CPD-15654
- common-name:
- 2-trans, 4-cis-undecadienoyl-coa
- smiles:
- ccccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- szkpluulggerfd-nfpsboapsa-j
- molecular-weight:
- 927.749