Difference between revisions of "CPD-3483"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ09197 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 4.2.2.10-RXN ** Catego...") |
(Created page with "Category:metabolite == Metabolite DIAMINONONANOATE == * common-name: ** 7,8-diaminopelargonate * smiles: ** cc(c(cccccc([o-])=o)[n+])[n+] * inchi-key: ** kcegbpiygiwcdh-uh...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite DIAMINONONANOATE == |
− | + | * common-name: | |
− | * | + | ** 7,8-diaminopelargonate |
− | + | * smiles: | |
− | * | + | ** cc(c(cccccc([o-])=o)[n+])[n+] |
− | * | + | * inchi-key: |
− | ** | + | ** kcegbpiygiwcdh-uhfffaoysa-o |
− | * | + | * molecular-weight: |
− | * | + | ** 189.277 |
− | *** | + | == Reaction(s) known to consume the compound == |
− | == | + | * [[DAPASYN-RXN]] |
− | * [[ | + | * [[DETHIOBIOTIN-SYN-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | {{#set: | + | * [[DAPASYN-RXN]] |
− | {{#set: | + | == Reaction(s) of unknown directionality == |
− | {{#set: | + | {{#set: common-name=7,8-diaminopelargonate}} |
+ | {{#set: inchi-key=inchikey=kcegbpiygiwcdh-uhfffaoysa-o}} | ||
+ | {{#set: molecular-weight=189.277}} |
Revision as of 20:33, 18 December 2020
Contents
Metabolite DIAMINONONANOATE
- common-name:
- 7,8-diaminopelargonate
- smiles:
- cc(c(cccccc([o-])=o)[n+])[n+]
- inchi-key:
- kcegbpiygiwcdh-uhfffaoysa-o
- molecular-weight:
- 189.277