Difference between revisions of "TETRACOSANOATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8631 RXN-8631] == * direction: ** left-to-right * common-name: ** fructose-bisphosphate aldolas...")
(Created page with "Category:metabolite == Metabolite PROPIONYL-COA == * common-name: ** propanoyl-coa * smiles: ** ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c...")
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8631 RXN-8631] ==
+
== Metabolite PROPIONYL-COA ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** fructose-bisphosphate aldolase
+
** propanoyl-coa
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/4.1.2.13 ec-4.1.2.13]
+
** ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
== Reaction formula ==
+
* inchi-key:
* 1 [[FRU1P]][c] '''=>''' 1 [[DIHYDROXY-ACETONE-PHOSPHATE]][c] '''+''' 1 [[GLYCERALD]][c]
+
** qaqrevbbadehpa-iexphmlfsa-j
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
** 819.566
* Gene: [[SJ13560]]
+
== Reaction(s) known to consume the compound ==
** Category: [[annotation]]
+
* [[METHYLACETOACETYLCOATHIOL-RXN]]
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[METHYLMALONYL-COA-DECARBOXYLASE-RXN]]
** Category: [[orthology]]
+
* [[PPCOAOm]]
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[PROPIONYL-COA-CARBOXY-RXN]]
* Gene: [[SJ22520]]
+
== Reaction(s) known to produce the compound ==
** Category: [[annotation]]
+
* [[1.2.1.27-RXN]]
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[2.3.1.176-RXN]]
** Category: [[orthology]]
+
* [[ACCAT]]
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[METHYLACETOACETYLCOATHIOL-RXN]]
* Gene: [[SJ12479]]
+
* [[METHYLMALONYL-COA-DECARBOXYLASE-RXN]]
** Category: [[annotation]]
+
* [[PPCOAOm]]
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[PROPIONYL-COA-CARBOXY-RXN]]
** Category: [[orthology]]
+
* [[RXN-11213]]
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-12561]]
* Gene: [[SJ21513]]
+
* [[RXN-7790]]
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: common-name=propanoyl-coa}}
** Category: [[orthology]]
+
{{#set: inchi-key=inchikey=qaqrevbbadehpa-iexphmlfsa-j}}
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: molecular-weight=819.566}}
* Gene: [[SJ17964]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
</div>
 
== Pathway(s)  ==
 
* [[PWY66-373]], sucrose degradation V (sucrose &alpha;-glucosidase): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-373 PWY66-373]
 
** '''3''' reactions found over '''5''' reactions in the full pathway
 
== Reconstruction information  ==
 
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30852 30852]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R02568 R02568]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=fructose-bisphosphate aldolase}}
 
{{#set: ec-number=ec-4.1.2.13}}
 
{{#set: nb gene associated=5}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=annotation|orthology}}
 
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Revision as of 20:34, 18 December 2020

Metabolite PROPIONYL-COA

  • common-name:
    • propanoyl-coa
  • smiles:
    • ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • qaqrevbbadehpa-iexphmlfsa-j
  • molecular-weight:
    • 819.566

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality