Difference between revisions of "Purine-Ribonucleosides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.1.90-RXN 2.7.1.90-RXN] == * direction: ** reversible * common-name: ** diphosphate:fructose-6-p...")
(Created page with "Category:metabolite == Metabolite CGMP == * common-name: ** cyclic-gmp * smiles: ** c4(c3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)op(o4)(=o)[o-])) * inchi-key: ** zoogrgp...")
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.1.90-RXN 2.7.1.90-RXN] ==
+
== Metabolite CGMP ==
* direction:
 
** reversible
 
 
* common-name:
 
* common-name:
** diphosphate:fructose-6-phosphate 1-phosphotransferase
+
** cyclic-gmp
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/2.7.1.90 ec-2.7.1.90]
+
** c4(c3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)op(o4)(=o)[o-]))
== Reaction formula ==
+
* inchi-key:
* 1 [[FRUCTOSE-6P]][c] '''+''' 1 [[PPI]][c] '''<=>''' 1 [[FRUCTOSE-16-DIPHOSPHATE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Pi]][c]
+
** zoogrgpoevqqdx-uuokfmhzsa-m
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ16394]]
+
** 344.2
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[35-CYCLIC-GMP-PHOSPHODIESTERASE-RXN]]
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
* [[PWY-1042]], glycolysis IV (plant cytosol): [http://metacyc.org/META/NEW-IMAGE?object=PWY-1042 PWY-1042]
+
* [[GUANYLCYC-RXN]]
** '''9''' reactions found over '''10''' reactions in the full pathway
+
== Reaction(s) of unknown directionality ==
== Reconstruction information  ==
+
{{#set: common-name=cyclic-gmp}}
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=zoogrgpoevqqdx-uuokfmhzsa-m}}
== External links  ==
+
{{#set: molecular-weight=344.2}}
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13616 13616]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R00764 R00764]
 
* UNIPROT:
 
** [http://www.uniprot.org/uniprot/P21342 P21342]
 
** [http://www.uniprot.org/uniprot/P29495 P29495]
 
** [http://www.uniprot.org/uniprot/O83146 O83146]
 
** [http://www.uniprot.org/uniprot/O84210 O84210]
 
** [http://www.uniprot.org/uniprot/P21343 P21343]
 
** [http://www.uniprot.org/uniprot/O51669 O51669]
 
** [http://www.uniprot.org/uniprot/Q27651 Q27651]
 
** [http://www.uniprot.org/uniprot/Q27659 Q27659]
 
** [http://www.uniprot.org/uniprot/O81437 O81437]
 
** [http://www.uniprot.org/uniprot/Q9STQ7 Q9STQ7]
 
** [http://www.uniprot.org/uniprot/Q41140 Q41140]
 
** [http://www.uniprot.org/uniprot/Q41141 Q41141]
 
** [http://www.uniprot.org/uniprot/Q9M076 Q9M076]
 
{{#set: direction=reversible}}
 
{{#set: common-name=diphosphate:fructose-6-phosphate 1-phosphotransferase}}
 
{{#set: ec-number=ec-2.7.1.90}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:34, 18 December 2020

Metabolite CGMP

  • common-name:
    • cyclic-gmp
  • smiles:
    • c4(c3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)op(o4)(=o)[o-]))
  • inchi-key:
    • zoogrgpoevqqdx-uuokfmhzsa-m
  • molecular-weight:
    • 344.2

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality