Difference between revisions of "Methionine-synthase-cob-II-alamins"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ04393 == * transcription-direction: ** positive * right-end-position: ** 12820 * left-end-position: ** 7673 * centisome-position: ** 7.1205845...")
(Created page with "Category:metabolite == Metabolite S-ADENOSYLMETHIONINAMINE == * common-name: ** s-adenosyl 3-(methylthio)propylamine * smiles: ** c[s+](ccc[n+])cc1(oc(c(o)c(o)1)n3(c=nc2(=...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ04393 ==
+
== Metabolite S-ADENOSYLMETHIONINAMINE ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** s-adenosyl 3-(methylthio)propylamine
−
* right-end-position:
+
* smiles:
−
** 12820
+
** c[s+](ccc[n+])cc1(oc(c(o)c(o)1)n3(c=nc2(=c(n)n=cn=c23)))
−
* left-end-position:
+
* inchi-key:
−
** 7673
+
** zunbitixdcpnsd-lsrjevitsa-o
−
* centisome-position:
+
* molecular-weight:
−
** 7.1205845   
+
** 356.442
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[APAPT]]
−
== Reaction(s) associated ==
+
* [[RXN-11190]]
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[RXN0-5217]]
−
* [[RXN-14950]]
+
* [[SPERMIDINESYN-RXN]]
−
** Category: [[annotation]]
+
* [[SPERMINE-SYNTHASE-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* [[RXN-14957]]
+
* [[AMCL]]
−
** Category: [[annotation]]
+
* [[RXN-11190]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[SAMDECARB-RXN]]
−
* [[RXN-14959]]
+
* [[SPERMIDINESYN-RXN]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=s-adenosyl 3-(methylthio)propylamine}}
−
* [[RXN-17127]]
+
{{#set: inchi-key=inchikey=zunbitixdcpnsd-lsrjevitsa-o}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=356.442}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-8654]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-8655]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN0-949]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
</div>
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7382]]
 
−
** '''4''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY0-522]]
 
−
** '''2''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-6984]]
 
−
** '''2''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY0-1275]]
 
−
** '''2''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY0-501]]
 
−
** '''2''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-6987]]
 
−
** '''2''' reactions found over '''3''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=12820}}
 
−
{{#set: left-end-position=7673}}
 
−
{{#set: centisome-position=7.1205845    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=7}}
 
−
{{#set: nb pathway associated=6}}
 

Revision as of 20:34, 18 December 2020

Metabolite S-ADENOSYLMETHIONINAMINE

  • common-name:
    • s-adenosyl 3-(methylthio)propylamine
  • smiles:
    • c[s+](ccc[n+])cc1(oc(c(o)c(o)1)n3(c=nc2(=c(n)n=cn=c23)))
  • inchi-key:
    • zunbitixdcpnsd-lsrjevitsa-o
  • molecular-weight:
    • 356.442

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Methionine-synthase-cob-II-alamins&oldid=47253"