Difference between revisions of "Saturated-Fatty-Acyl-CoA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17127 RXN-17127] == * direction: ** left-to-right * common-name: ** lipoate-protein ligase * ec...")
(Created page with "Category:metabolite == Metabolite CPD-15839 == * common-name: ** δ-tocotrienol * smiles: ** cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=cc(=cc=2c)o)))c)c)c * inchi-key: ** o...")
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17127 RXN-17127] ==
+
== Metabolite CPD-15839 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** lipoate-protein ligase
+
** δ-tocotrienol
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/6.3.1.20 ec-6.3.1.20]
+
** cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=cc(=cc=2c)o)))c)c)c
== Reaction formula ==
+
* inchi-key:
* 1 [[ATP]][c] '''+''' 1 [[LIPOIC-ACID]][c] '''+''' 1 [[Lipoyl-Protein-L-Lysine]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[Lipoyl-Protein-N6-lipoyllysine]][c] '''+''' 1 [[PPI]][c] '''+''' 1 [[PROTON]][c]
+
** odadklylwwchnb-ldybvbfysa-n
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ06657]]
+
** 396.612
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-14919]]
* Gene: [[SJ03663]]
+
== Reaction(s) known to produce the compound ==
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
{{#set: common-name=δ-tocotrienol}}
* Gene: [[SJ04393]]
+
{{#set: inchi-key=inchikey=odadklylwwchnb-ldybvbfysa-n}}
** Category: [[annotation]]
+
{{#set: molecular-weight=396.612}}
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ11692]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
== Pathway(s) ==
 
== Reconstruction information  ==
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=49289 49289]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=lipoate-protein ligase}}
 
{{#set: ec-number=ec-6.3.1.20}}
 
{{#set: nb gene associated=4}}
 
{{#set: nb pathway associated=0}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:34, 18 December 2020

Metabolite CPD-15839

  • common-name:
    • δ-tocotrienol
  • smiles:
    • cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=cc(=cc=2c)o)))c)c)c
  • inchi-key:
    • odadklylwwchnb-ldybvbfysa-n
  • molecular-weight:
    • 396.612

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality